CymitQuimica logo

CAS 19967-65-8

:

2(5H)-Thiazolone, 4-amino-

Description:
2(5H)-Thiazolone, 4-amino- is an organic compound characterized by its thiazolone structure, which features a five-membered ring containing both sulfur and nitrogen atoms. This compound typically exhibits properties associated with thiazoles and thiazolones, such as being a heterocyclic compound with potential biological activity. The presence of an amino group at the 4-position enhances its reactivity and solubility in polar solvents. It may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it useful in synthetic organic chemistry. Additionally, compounds of this nature can exhibit antimicrobial or antifungal properties, which may be of interest in pharmaceutical applications. The molecular structure contributes to its potential as a building block in the synthesis of more complex molecules. As with many thiazolone derivatives, it is important to handle this compound with care, considering safety data and potential hazards associated with its use in laboratory settings.
Formula:C3H4N2OS
InChI:InChI=1S/C3H4N2OS/c4-2-1-7-3(6)5-2/h1H2,(H2,4,5,6)
InChI key:PECKLIXQHBFLKD-UHFFFAOYSA-N
SMILES:C1C(=NC(=O)S1)N
Found 4 products.