CymitQuimica logo

CAS 199682-73-0

:

3-(4-methoxyphenyl)-1H-pyrazole-4-carbaldehyde

Description:
3-(4-Methoxyphenyl)-1H-pyrazole-4-carbaldehyde is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a methoxy group (-OCH3) attached to the phenyl ring enhances its solubility in organic solvents and may influence its reactivity and biological activity. The aldehyde functional group (-CHO) at the 4-position of the pyrazole contributes to its potential as a reactive intermediate in various chemical reactions, including condensation and oxidation processes. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various substitution patterns, which can be explored for the development of derivatives with enhanced activity or selectivity. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, 3-(4-methoxyphenyl)-1H-pyrazole-4-carbaldehyde represents a versatile building block in organic synthesis and drug development.
Formula:C11H10N2O2
InChI:InChI=1/C11H10N2O2/c1-15-10-4-2-8(3-5-10)11-9(7-14)6-12-13-11/h2-7H,1H3,(H,12,13)
InChI key:QSGGFCPKXTULQQ-UHFFFAOYSA-N
SMILES:COc1ccc(cc1)c1c(c[nH]n1)C=O
Found 4 products.