CymitQuimica logo

CAS 20001-65-4

:

Benzene, 1-chloro-4-(1-chloroethyl)-

Description:
Benzene, 1-chloro-4-(1-chloroethyl)-, also known as 1,4-dichloro-2-ethylbenzene, is an organic compound characterized by a benzene ring substituted with two chlorine atoms and an ethyl group. The presence of chlorine atoms introduces significant polarity to the molecule, affecting its reactivity and solubility. This compound is typically a colorless liquid with a distinct aromatic odor, and it is insoluble in water but soluble in organic solvents. Its chemical structure allows for various reactions, including nucleophilic substitution and electrophilic aromatic substitution, making it useful in synthetic organic chemistry. Due to the presence of chlorine, it may exhibit toxicity and environmental persistence, necessitating careful handling and disposal. Additionally, it may have applications in the production of other chemicals or as an intermediate in various industrial processes. Safety data sheets should be consulted for specific handling and exposure guidelines, as chlorinated compounds can pose health risks.
Formula:C8H8Cl2
InChI:InChI=1S/C8H8Cl2/c1-6(9)7-2-4-8(10)5-3-7/h2-6H,1H3
InChI key:NOCHRVHWICTPLG-UHFFFAOYSA-N
SMILES:CC(C1=CC=C(C=C1)Cl)Cl
Found 4 products.