CymitQuimica logo

CAS 2000187-73-3

:

B-[2-Chloro-4-(4-morpholinylcarbonyl)phenyl]boronic acid

Description:
B-[2-Chloro-4-(4-morpholinylcarbonyl)phenyl]boronic acid is a boronic acid derivative characterized by its boron atom bonded to a phenyl ring that contains a chlorine substituent and a morpholinylcarbonyl group. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the morpholine moiety suggests potential for biological activity, as morpholine derivatives are often found in pharmaceuticals. The chlorine atom may influence the compound's reactivity and solubility, while the boronic acid functionality allows for participation in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Overall, this compound's unique structure and functional groups make it a valuable candidate for research in drug development and materials science.
Formula:C11H13BClNO4
InChI:InChI=1S/C11H13BClNO4/c13-10-7-8(1-2-9(10)12(16)17)11(15)14-3-5-18-6-4-14/h1-2,7,16-17H,3-6H2
InChI key:InChIKey=OQKJPQSIYRSBBW-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(Cl)=C(B(O)O)C=C1)N2CCOCC2
Synonyms:
  • B-[2-Chloro-4-(4-morpholinylcarbonyl)phenyl]boronic acid
  • Boronic acid, B-[2-chloro-4-(4-morpholinylcarbonyl)phenyl]-
Found 3 products.