CAS 200052-70-6
:Propanedinitrile,[2-(1,1-dimethylethyl)-6-[2-(2,3,6,7-tetrahydro-1,1,7,7-tetramethyl-1H,5H-benzo[ij]quinolizin-9-yl)ethenyl]-4H-pyran-4-ylidene]-
Description:
Propanedinitrile, with the specific name you provided, is a complex organic compound characterized by its unique structure that includes a pyran ring and multiple functional groups, including nitrile groups. The presence of the bulky tert-butyl group and the tetrahydrobenzoquinolizine moiety contributes to its steric hindrance and potentially influences its reactivity and solubility. This compound is likely to exhibit properties typical of nitriles, such as being polar and having a high boiling point relative to non-polar compounds of similar molecular weight. Its structure suggests potential applications in organic synthesis or as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of multiple functional groups may also impart interesting optical or electronic properties, making it a candidate for further study in materials science or medicinal chemistry. However, specific physical and chemical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications.
Formula:C30H35N3O
InChI:InChI=1S/C30H35N3O/c1-28(2,3)26-17-21(22(18-31)19-32)16-23(34-26)9-8-20-14-24-27-25(15-20)30(6,7)11-13-33(27)12-10-29(24,4)5/h8-9,14-17H,10-13H2,1-7H3/b9-8+
InChI key:HXWWMGJBPGRWRS-CMDGGOBGSA-N
SMILES:CC1(CCN2CCC(C3=C2C1=CC(=C3)/C=C/C4=CC(=C(C#N)C#N)C=C(O4)C(C)(C)C)(C)C)C
Synonyms:- Dcjtb
- 4-(Dicyanomethylene)-2-Tert-Butyl-6-(1,1,7,7-Tetramethyljulolidin-4-Yl-Vinyl)-4H-Pyran
- 4-(Dicyanomethylene)-2-T-Butyl-6-(1,1,7,7-Tetramethyljulolidyl-9-Enyl)-4h-Pyran
- Propanedinitrile,2-[2-(1,1-dimethylethyl)-6-[2-(2
- 4-(Dicyanomethylene)-2-T-Butyl-6-(1,1,7,7-Tetramethyljulolidyl-9-Enyl)-4H-Pyran (Dcjtb)
- Propanedinitrile, 2-[2-(1,1-dimethylethyl)-6-[2-(2,3,6,7-tetrahydro-1,1,7,7-tetramethyl-1H,5H-benzo[ij]quinolizin-9-yl)ethenyl]-4H-pyran-4-ylidene]-
- Lt-E704
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
DCJTB
CAS:Formula:C30H35N3OPurity:>98.0%(HPLC)(N)Color and Shape:Orange to Brown to Dark red powder to crystalMolecular weight:453.634-(Dicyanomethylene)-2-tert-butyl-6-(1,1,7,7-tetramethyljulolidin-4-yl-vinyl)-4H-pyran
CAS:Formula:C30H35N3OPurity:98%Color and Shape:SolidMolecular weight:453.61844-(Dicyanomethylene)-2-Tert-Butyl-6-(1,1,7,7-Tetramethyljulolidin-4-Yl-Vinyl)-4H-Pyran
CAS:4-(Dicyanomethylene)-2-Tert-Butyl-6-(1,1,7,7-Tetramethyljulolidin-4-Yl-Vinyl)-4H-PyranFormula:C30H35N3OPurity:98%Molecular weight:453.62DCJTB
CAS:4-(Dicyanomethylene)-2-tert-butyl-6-(1,1,7,7-tetramethyljulolidin-4-yl-vinyl)-4H-pyranFormula:C30H35N3OPurity:98%Molecular weight:453.624-(Dicyanomethylene)-2-tert-butyl-6-(1,1,7,7-tetramethyljulol
CAS:4-(Dicyanomethylene)-2-tert-butyl-6-(1,1,7,7-tetramethyljulolidinium) (DCJTB) is a red fluorescent dye that emits light when activated by heat. DCJTB is cationic and can be polymerized thermally or chemically. The molecule has been shown to be activated by the addition of an electron donor such as a metal chelate. This reaction takes place in the solution phase. DCJTB has been used for the diagnosis of nonpolar solvents such as gasoline and oil leaks in machine parts. DCJTB has also been used to detect groundwater contamination with trichloroethylene (TCE).
Formula:C30H35N3OPurity:Min. 95%Molecular weight:453.62 g/molRef: 3D-FD37255
Discontinued product




