CAS 200127-93-1

10-[(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-4H-naphtho[1,2-b]pyran-4-one

Description:

The chemical substance known as "10-[(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-4H-naphtho[1,2-b]pyran-4-one," with the CAS number 200127-93-1, is a complex organic compound characterized by its naphthopyran structure, which is a fused ring system containing both naphthalene and pyran moieties. This compound features multiple functional groups, including hydroxyl (-OH), methoxy (-OCH3), and glycosyl (-O-β-D-glucopyranosyl) groups, contributing to its potential biological activity and solubility properties. The presence of glycosylation suggests that it may exhibit enhanced stability and bioavailability, making it of interest in pharmacological research. Its structural complexity indicates potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Additionally, the compound may possess antioxidant or anti-inflammatory properties, typical of many flavonoid-like structures, although specific biological activities would require further investigation through experimental studies. Overall, this compound exemplifies the intricate relationship between structure and function in organic chemistry.

Formula: C₂₇H₃₂O₁₅

InChI: InChI=1S/C27H32O15/c1-9-3-12(29)18-13(30)5-10-4-11(37-2)6-14(17(10)25(18)39-9)40-27-24(36)22(34)20(32)16(42-27)8-38-26-23(35)21(33)19(31)15(7-28)41-26/h3-6,15-16,19-24,26-28,30-36H,7-8H2,1-2H3/t15-,16-,19-,20-,21+,22+,23-,24-,26-,27-/m1/s1

InChI key: InChIKey=CREWSFDYWMXJQL-YCPAWSGYSA-N

SMILES: O(C=1C2=C3C(=C(O)C=C2C=C(OC)C1)C(=O)C=C(C)O3)[C@@H]4O[C@H](CO[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O

Synonyms:

• 4H-Naphtho[1,2-b]pyran-4-one, 10-[(6-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-
• 10-[(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-8-methoxy-2-methyl-4H-naphtho[1,2-b]pyran-4-one
• Isorubrofusarin gentiobioside

Isorubrofusarin-6-O-β-gentiobioside

CAS: 200127-93-1

Formula: C₂₇H₃₂O₁₅

Molecular weight: 596.54

Ref: 7W-GY7303

Isorubrofusarin-6-O-β-gentiobioside

CAS: 200127-93-1

Isorubrofusarin-6-O-β-gentiobioside

Purity: ≥98%

Molecular weight: 596.53g/mol

Ref: 54-BUP00546

Isorubrofusarin-6-O-β-gentiobioside

CAS: 200127-93-1

Isorubrofusarin-6-O-β-gentiobioside is derived from from Cassia obtusifolia Linn seeds and shows promising inhibitory activity against AChE and BACE1.

Formula: C₂₇H₃₂O₁₅

Purity: 99.89%

Color and Shape: Solid

Molecular weight: 596.53

Ref: TM-TN1799

Isorubrofusarin-6-O-β-gentiobioside

CAS: 200127-93-1

Formula: C₂₇H₃₂O₁₅

Purity: 95%~99%

Molecular weight: 596.538

Ref: BP-BP4453

Isorubrofusarin-6-o-β-gentiobioside

CAS: 200127-93-1

Isorubrofusarin-6-o-β-gentiobioside is a natural compound that belongs to the class of naphthopyrone glycosides. This compound is primarily sourced from the fungi of the genus Aspergillus, known for their diverse secondary metabolites. The unique structural configuration, which includes a naphthopyrone core linked to a gentiobioside sugar moiety, enables it to interact effectively with biological membranes and proteins.

Formula: C₂₇H₃₂O₁₅

Purity: Min. 95%

Molecular weight: 596.5 g/mol

Ref: 3D-AIA12793