CAS 20016-85-7
:(R)-2-Hydroxybutanoic acid
Description:
(R)-2-Hydroxybutanoic acid, also known as L-threonine, is an alpha-hydroxy acid characterized by its chiral center, which gives rise to its specific (R) configuration. This compound is a colorless, crystalline solid that is soluble in water due to its polar hydroxyl and carboxylic acid functional groups. It has a molecular formula of C4H8O3 and features a hydroxyl group (-OH) attached to the second carbon of the butanoic acid chain, contributing to its acidity and reactivity. As a naturally occurring amino acid, it plays a crucial role in protein synthesis and is essential for various metabolic processes in living organisms. Its stereochemistry influences its biological activity, making it important in biochemical pathways. Additionally, (R)-2-Hydroxybutanoic acid can be utilized in various industrial applications, including pharmaceuticals and food additives, due to its functional properties. Its CAS number, 20016-85-7, is a unique identifier that facilitates its recognition in chemical databases and regulatory frameworks.
Formula:C4H8O3
InChI:InChI=1S/C4H8O3/c1-2-3(5)4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m1/s1
InChI key:InChIKey=AFENDNXGAFYKQO-GSVOUGTGSA-N
SMILES:[C@H](C(O)=O)(CC)O
Synonyms:- (-)-2-Hydroxy-n-butyric acid
- (-)-2-Hydroxybutanoic acid
- (-)-2-Hydroxybutyric acid
- (-)-α-Hydroxybutyric acid
- (2R)-2-hydroxybutanoic acid
- (3R)-3-hydroxybutanoic acid
- (R)-2-Hydroxybutanoic acid
- (R)-2-Hydroxybutyric acid
- (R)-3-Hydroxybutyrate
- (R)-α-Hydroxybutyric acid
- <span class="text-smallcaps">D</span>-(-)-α-Hydroxybutyric acid
- <span class="text-smallcaps">D</span>-2-Hydroxybutyric acid
- Butanoic acid, 2-hydroxy-, (2R)-
- Butanoic acid, 2-hydroxy-, (R)-
- Butyric acid, 2-hydroxy-, <span class="text-smallcaps">D</span>-
- Butyric acid, 2-hydroxy-, D-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(R)-2-Hydroxybutanoic acid
CAS:(R)-2-Hydroxybutanoic acidFormula:C4H8O3Purity:97%Color and Shape:Solid-CrystalsMolecular weight:104.10452(R)-2-Hydroxybutanoic acid
CAS:(R)-2-Hydroxybutanoic acid is an isomer of 2-Hydroxybutyric acid, often used as a control compound in experiments. 2-Hydroxybutyric acid (α-Hydroxybutyric acid) is derived from 2-Aminobutyric acid, with 2-oxobutyric acid serving as an intermediate metabolite.Formula:C4H8O3Color and Shape:SolidMolecular weight:104.10(R)-2-Hydroxybutanoic Acid
CAS:Controlled ProductApplications (R)-2-Hydroxybutanoic acid (cas# 20016-85-7) is a useful research chemical.
Formula:C4H8O3Color and Shape:NeatMolecular weight:104.105(R)-2-Hydroxybutanoic acid
CAS:(R)-2-Hydroxybutanoic acidFormula:C4H8O3Purity:95%Molecular weight:104.1Butanoic acid, 2-hydroxy-, (2R)-
CAS:Formula:C4H8O3Purity:95%Color and Shape:SolidMolecular weight:104.1045





