CymitQuimica logo

CAS 2004388-06-9

:

2-(2-(thiophen-3-yl)phenyl)acetic acid

Description:
2-(2-(Thiophen-3-yl)phenyl)acetic acid is an organic compound characterized by its unique structure, which includes a thiophene ring and a phenyl group connected by an acetic acid moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions due to the presence of functional groups. The thiophene ring contributes to its electronic properties, potentially enhancing its reactivity and solubility in organic solvents. The acetic acid functional group provides acidic characteristics, allowing for potential interactions in biological systems or with other chemical entities. This compound may be of interest in medicinal chemistry and materials science due to its structural features, which could influence biological activity or material properties. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopy and chromatography, to confirm its identity and purity. Overall, 2-(2-(thiophen-3-yl)phenyl)acetic acid represents a versatile structure with potential applications in various fields of research.
Formula:C12H10O2S
InChI:InChI=1S/C12H10O2S/c13-12(14)7-9-3-1-2-4-11(9)10-5-6-15-8-10/h1-6,8H,7H2,(H,13,14)
InChI key:OFOGWDJJPKGWFM-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)CC(=O)O)C2=CSC=C2
Synonyms:
  • 2-(2-(thiophen-3-yl)phenyl)acetic acid
  • Benzeneacetic acid, 2-(3-thienyl)-
Found 4 products.