CymitQuimica logo

CAS 2006-14-6

:

2-Propenoic acid, 3-(1-naphthalenyl)-, (2E)-

Description:
2-Propenoic acid, 3-(1-naphthalenyl)-, (2E)-, commonly known as 3-(1-naphthyl)acrylic acid, is an organic compound characterized by its structure, which features a naphthalene ring attached to an acrylic acid moiety. This compound is a derivative of acrylic acid, possessing a double bond between the first and second carbon atoms of the propene chain, which contributes to its reactivity. The presence of the naphthalene group imparts unique aromatic properties, influencing its solubility and stability. Typically, 3-(1-naphthyl)acrylic acid exhibits moderate solubility in organic solvents while being less soluble in water due to its hydrophobic naphthalene component. It can participate in various chemical reactions, including polymerization and esterification, making it valuable in the synthesis of polymers and other chemical intermediates. Additionally, this compound may exhibit biological activity, which can be of interest in medicinal chemistry and materials science. Its CAS number, 2006-14-6, is a unique identifier that facilitates its recognition in chemical databases and regulatory frameworks.
Formula:C13H10O2
InChI:InChI=1S/C13H10O2/c14-13(15)9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-9H,(H,14,15)/b9-8+
InChI key:WPXMLUUYWNHQOR-CMDGGOBGSA-N
SMILES:C1=CC=C2C(=C1)C=CC=C2/C=C/C(=O)O
Found 7 products.