CAS 2006-14-6
:2-Propenoic acid, 3-(1-naphthalenyl)-, (2E)-
Description:
2-Propenoic acid, 3-(1-naphthalenyl)-, (2E)-, commonly known as 3-(1-naphthyl)acrylic acid, is an organic compound characterized by its structure, which features a naphthalene ring attached to an acrylic acid moiety. This compound is a derivative of acrylic acid, possessing a double bond between the first and second carbon atoms of the propene chain, which contributes to its reactivity. The presence of the naphthalene group imparts unique aromatic properties, influencing its solubility and stability. Typically, 3-(1-naphthyl)acrylic acid exhibits moderate solubility in organic solvents while being less soluble in water due to its hydrophobic naphthalene component. It can participate in various chemical reactions, including polymerization and esterification, making it valuable in the synthesis of polymers and other chemical intermediates. Additionally, this compound may exhibit biological activity, which can be of interest in medicinal chemistry and materials science. Its CAS number, 2006-14-6, is a unique identifier that facilitates its recognition in chemical databases and regulatory frameworks.
Formula:C13H10O2
InChI:InChI=1S/C13H10O2/c14-13(15)9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-9H,(H,14,15)/b9-8+
InChI key:WPXMLUUYWNHQOR-CMDGGOBGSA-N
SMILES:C1=CC=C2C(=C1)C=CC=C2/C=C/C(=O)O
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(E)-3-(Naphth-1-yl)acrylic acid
CAS:(E)-3-(Naphth-1-yl)acrylic acidFormula:C13H10O2Purity:≥98%Molecular weight:198.22(E)-3-(Naphthalen-1-yl)acrylic acid
CAS:Formula:C13H10O2Purity:98%Color and Shape:SolidMolecular weight:198.2173(E)-3-(Naphth-1-yl)acrylic acid
CAS:(E)-3-(Naphth-1-yl)acrylic acid (3-(1-Naphthyl)acrylic acid) is a biochemical reagent that can be used to synthesize a variety of compounds and participate inFormula:C13H10O2Purity:99.94%Color and Shape:SolidMolecular weight:198.22(E)-3-(Naphthalen-1-yl)acrylic acid
CAS:(E)-3-(Naphthalen-1-yl)acrylic acidFormula:C13H10O2Purity:98%Molecular weight:198.22(E)-3-(Naphth-1-yl)acrylic acid
CAS:(E)-3-(Naphth-1-yl)acrylic acidFormula:C13H10O2Purity:≥95%Color and Shape:SolidMolecular weight:198.2173(E)-3-(Naphthalen-1-yl)acrylic Acid
CAS:(E)-3-(Naphthalen-1-yl)acrylic acid is an organic compound that belongs to the class of cinnamic acids derivatives. It is a white crystalline solid that has a melting point of 124 degrees Celsius. This molecule can be hydrolyzed in alkaline solution and is soluble in water. (E)-3-(Naphthalen-1-yl)acrylic acid has been shown to have antimicrobial properties, which may be due to its ability to inhibit propiolic acid synthesis by nitrite. The functional theory suggests that this molecule will react with a nucleophile on the target cell's surface and form an ion pair, which leads to an increased permeability of the cell membrane and the release of cytoplasmic contents.Formula:C13H10O2Purity:Min. 95%Molecular weight:198.22 g/mol





