CymitQuimica logo

CAS 2007924-94-7

:

ethyl 2-(1-{[1-(2-ethoxy-2-oxoethyl)cyclopropyl]amino}cyclopropyl)acetate

Description:
Ethyl 2-(1-{[1-(2-ethoxy-2-oxoethyl)cyclopropyl]amino}cyclopropyl)acetate is a complex organic compound characterized by its unique structural features, including multiple cyclopropyl groups and an ethoxy-2-oxoethyl moiety. This compound is likely to exhibit properties typical of esters, such as volatility and solubility in organic solvents. The presence of the cyclopropyl rings may impart strain and influence its reactivity, potentially making it a candidate for various chemical reactions, including nucleophilic substitutions or cycloadditions. The ethoxy group suggests that it may participate in reactions typical of ethers, while the acetate functionality indicates potential for hydrolysis under acidic or basic conditions. Additionally, the compound may exhibit biological activity due to its amine and ester functionalities, which could interact with biological systems. Overall, the characteristics of this compound suggest it may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific biological or chemical properties would require empirical investigation.
Formula:C14H23NO4
InChI:InChI=1S/C14H23NO4/c1-3-18-11(16)9-13(5-6-13)15-14(7-8-14)10-12(17)19-4-2/h15H,3-10H2,1-2H3
InChI key:InChIKey=FFRMGHFUVGAIBZ-UHFFFAOYSA-N
SMILES:N(C1(CC(OCC)=O)CC1)C2(CC(OCC)=O)CC2
Synonyms:
  • Diethyl 2,2’-[Azanediylbis(cyclopropane-1,1-diyl)]diacetate
  • ethyl 2-(1-{[1-(2-ethoxy-2-oxoethyl)cyclopropyl]amino}cyclopropyl)acetate
Found 1 products.