CymitQuimica logo

CAS 201138-91-2

:

Dibenzofuran, 4,6-dibromo-

Description:
Dibenzofuran, 4,6-dibromo- is an organic compound characterized by the presence of a dibenzofuran core structure with bromine substituents at the 4 and 6 positions. This compound belongs to the class of dibenzofurans, which are polycyclic aromatic compounds known for their fused benzene rings and an oxygen atom in the central furan ring. The bromine atoms introduce significant changes in the compound's physical and chemical properties, such as increased molecular weight and potential for enhanced reactivity. Typically, dibenzofurans exhibit hydrophobic characteristics, making them less soluble in water but soluble in organic solvents. The presence of bromine can also influence the compound's electronic properties, potentially affecting its behavior in chemical reactions and interactions with biological systems. Additionally, compounds like dibenzofuran, 4,6-dibromo- may have implications in environmental chemistry, particularly concerning their persistence and bioaccumulation in ecosystems. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can pose health and environmental risks.
Formula:C12H6Br2O
InChI:InChI=1S/C12H6Br2O/c13-9-5-1-3-7-8-4-2-6-10(14)12(8)15-11(7)9/h1-6H
InChI key:XSJLDNSNUICSQC-UHFFFAOYSA-N
SMILES:C1=CC2=C(C(=C1)Br)OC3=C2C=CC=C3Br
Synonyms:
  • 4,6-Dibromodibenzofuran
  • 4,6-Dibromodibenzo[B,D]Furan
Found 5 products.