CAS 20119-28-2
:2-(3,3-Dimethyl-1-triazen-1-yl)benzoic acid
Description:
2-(3,3-Dimethyl-1-triazen-1-yl)benzoic acid, with the CAS number 20119-28-2, is an organic compound characterized by its triazenyl functional group attached to a benzoic acid moiety. This compound typically exhibits properties associated with both aromatic and acidic functionalities. The presence of the triazenyl group contributes to its potential reactivity, particularly in the context of azo coupling reactions, which are significant in dye chemistry. The benzoic acid part of the molecule provides acidic characteristics, allowing it to participate in various chemical reactions, including esterification and salt formation. Additionally, the dimethyl substitution on the triazenyl group may influence the compound's solubility and stability. Overall, this compound is of interest in fields such as organic synthesis and materials science, particularly for its potential applications in dye production and as a reagent in chemical research. Its specific physical properties, such as melting point and solubility, would need to be determined experimentally or sourced from reliable chemical databases.
Formula:C9H11N3O2
InChI:InChI=1S/C9H11N3O2/c1-12(2)11-10-8-6-4-3-5-7(8)9(13)14/h3-6H,1-2H3,(H,13,14)
InChI key:InChIKey=IUQFGMCLWBGIIA-UHFFFAOYSA-N
SMILES:N(=NN(C)C)C1=C(C(O)=O)C=CC=C1
Synonyms:- 1-(2-Carboxyphenyl)-3,3-dimethyltriazene
- 2-(3,3-Dimethyl-1-triazen-1-yl)benzoic acid
- 2-(3,3-Dimethyltriazen-1-yl)benzoic acid
- 2-[(1E)-3,3-dimethyltriaz-1-en-1-yl]benzoic acid
- Benzoic acid, 2-(3,3-dimethyl-1-triazen-1-yl)-
- Benzoic acid, 2-(3,3-dimethyl-1-triazenyl)-
- Benzoic acid, 2-(3,3-dimethyl-1-triazenyl)- (9CI)
- Benzoic acid, o-(3,3-dimethyl-1-triazeno)-
- Benzoic acid, o-(3,3-dimethyl-1-triazeno)- (8CI)
- NSC 210718
- NSC 226088
- Nsc 140114
- See more synonyms
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
