CymitQuimica logo

CAS 201292-99-1

:

Ac-Tyr(tBu)-OH

Description:
Ac-Tyr(tBu)-OH, also known as Acetyltyrosine tert-butyl ester, is a derivative of the amino acid tyrosine, characterized by the presence of an acetyl group and a tert-butyl protecting group on the hydroxyl side chain. This compound is typically used in peptide synthesis and as a building block in the development of pharmaceuticals and biochemicals. The acetyl group enhances the solubility and stability of the molecule, while the tert-butyl group serves to protect the hydroxyl group during chemical reactions, preventing unwanted side reactions. Ac-Tyr(tBu)-OH is generally stable under standard laboratory conditions but should be handled with care, as with all chemical substances. Its structure allows for specific interactions in biological systems, making it valuable in research related to protein synthesis and modification. Additionally, the compound may exhibit unique properties such as altered solubility and reactivity compared to its unprotected counterparts, which can be advantageous in various synthetic applications.
Formula:C15H21NO4
InChI:InChI=1S/C15H21NO4/c1-10(17)16-13(14(18)19)9-11-5-7-12(8-6-11)20-15(2,3)4/h5-8,13H,9H2,1-4H3,(H,16,17)(H,18,19)/t13-/m0/s1
InChI key:JLNUTWJSFBIAAS-ZDUSSCGKSA-N
SMILES:CC(=O)N[C@@H](CC1=CC=C(C=C1)OC(C)(C)C)C(=O)O
Found 4 products.