CymitQuimica logo

CAS 201403-02-3

:

2-amino-2-(4-bromophenyl)ethanol

Description:
2-amino-2-(4-bromophenyl)ethanol is an organic compound characterized by the presence of both an amino group and a hydroxyl group attached to a carbon chain. This compound features a brominated phenyl group, which contributes to its unique chemical properties. The amino group (-NH2) is a basic functional group, making the compound potentially reactive in various chemical reactions, including nucleophilic substitutions. The hydroxyl group (-OH) provides the compound with alcohol characteristics, influencing its solubility in polar solvents and its ability to participate in hydrogen bonding. The presence of the bromine atom enhances the compound's reactivity, particularly in electrophilic aromatic substitution reactions. Additionally, the compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and pharmacology. Its molecular structure suggests potential applications in the synthesis of pharmaceuticals or as an intermediate in organic synthesis. Overall, 2-amino-2-(4-bromophenyl)ethanol is a versatile compound with significant implications in both chemical research and practical applications.
Formula:C8H10BrNO
InChI:InChI=1S/C8H10BrNO/c9-7-3-1-6(2-4-7)8(10)5-11/h1-4,8,11H,5,10H2
InChI key:KTNHFPRYCCCOQV-UHFFFAOYSA-N
SMILES:c1cc(ccc1C(CO)N)Br
Found 5 products.