CymitQuimica logo

CAS 201419-15-0

:

Boc-Homocys(Mbzl)-OH

Description:
Boc-Homocys(Mbzl)-OH, with the CAS number 201419-15-0, is a chemical compound that features a protected form of homocysteine, an amino acid that plays a crucial role in various biological processes. The "Boc" (tert-butyloxycarbonyl) group serves as a protective group for the amino functionality, which is commonly used in peptide synthesis to prevent unwanted reactions. The "Mbzl" (benzyl) group indicates the presence of a benzyl moiety, which can enhance the compound's lipophilicity and stability. This compound is typically utilized in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals and peptides. Its characteristics include being a white to off-white solid, with solubility in organic solvents, and it may exhibit specific reactivity patterns due to the presence of the amino and hydroxyl groups. As with many chemical substances, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C17H25NO4S
InChI:InChI=1S/C17H25NO4S/c1-12-5-7-13(8-6-12)11-23-10-9-14(15(19)20)18-16(21)22-17(2,3)4/h5-8,14H,9-11H2,1-4H3,(H,18,21)(H,19,20)/t14-/m0/s1
InChI key:LIUGCVMBJYHYNA-AWEZNQCLSA-N
SMILES:CC1=CC=C(C=C1)CSCC[C@@H](C(=O)O)NC(=O)OC(C)(C)C
Found 2 products.