CymitQuimica logo

CAS 201611-77-0

:

Benzenecarbodithioic acid, 1-methyl-1-phenylethyl ester

Description:
Benzenecarbodithioic acid, 1-methyl-1-phenylethyl ester, identified by its CAS number 201611-77-0, is an organic compound characterized by the presence of a dithioic acid functional group and an ester linkage. This compound typically exhibits a yellow to brown color and is soluble in organic solvents, reflecting its non-polar characteristics. The presence of the methyl and phenyl groups contributes to its hydrophobic nature and may influence its reactivity and interaction with other chemical species. As a dithioic acid derivative, it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its applications could span across fields such as organic synthesis, materials science, and potentially in the development of agrochemicals or pharmaceuticals, although specific applications may vary based on its reactivity and stability. Safety data should be consulted for handling and storage, as compounds with similar structures can exhibit toxicity or environmental hazards.
Formula:C16H16S2
InChI:InChI=1S/C16H16S2/c1-16(2,14-11-7-4-8-12-14)18-15(17)13-9-5-3-6-10-13/h3-12H,1-2H3
InChI key:KOBJYYDWSKDEGY-UHFFFAOYSA-N
SMILES:CC(C)(C1=CC=CC=C1)SC(=S)C2=CC=CC=C2
Found 7 products.