CAS 201802-67-7
:4-(Diphenylamino)phenylboronic acid
Description:
4-(Diphenylamino)phenylboronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a diphenylamino group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. The boronic acid moiety allows for reversible interactions with diols, making it useful in various applications, including organic synthesis and as a building block in materials science. The diphenylamino group contributes to its electronic properties, potentially enhancing its photophysical characteristics, which may be beneficial in optoelectronic applications. Additionally, this compound may exhibit moderate stability under ambient conditions but should be handled with care due to the potential reactivity of the boronic acid group. Overall, 4-(Diphenylamino)phenylboronic acid is of interest in research fields such as organic chemistry, materials science, and medicinal chemistry due to its unique structural features and functional capabilities.
Formula:C18H16BNO2
InChI:InChI=1/C18H16BNO2/c21-19(22)15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,21-22H
SMILES:c1ccc(cc1)N(c1ccccc1)c1ccc(cc1)B(O)O
Synonyms:- [4-(Diphenylamino)phenyl]boronic acid
- boronic acid, B-[4-(diphenylamino)phenyl]-
- Triphenylamine-4-Boronic Acid
- 4-(Diphenyamino) phenylboronic acid
- [4-(N-phenylanilino)phenyl]boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Diphenylamino)phenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C18H16BNO2Purity:97.0 to 108.0 %Color and Shape:White to Dark green powder to crystalMolecular weight:289.144-(Diphenylamino)benzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C18H16BNO2Purity:98%Molecular weight:289.14Boronic acid, B-[4-(diphenylamino)phenyl]-
CAS:Formula:C18H16BNO2Purity:98%Color and Shape:SolidMolecular weight:289.1361Ref: IN-DA0027U6
1g23.00€5g25.00€10g40.00€25g61.00€100g185.00€500g589.00€5kg5,715.00€10kg10,155.00€25kg25,381.00€4-Diphenylamino-phenylboronic acid
CAS:4-Diphenylamino-phenylboronic acidFormula:C18H16BNO2Purity:98%Color and Shape:Solid-PowderMolecular weight:289.136144-(Diphenylamino)phenylboronic acid
CAS:Formula:C18H16BNO2Purity:98%Color and Shape:SolidMolecular weight:289.14




