CAS 20189-11-1

Phen-2,3,4,5-d4-ol-d,6-methoxy- (8CI,9CI)

Description:

Phen-2,3,4,5-d4-ol-d,6-methoxy- (8CI,9CI), with the CAS number 20189-11-1, is a deuterated phenolic compound characterized by the presence of deuterium isotopes at specific positions on the phenolic ring. This compound features a methoxy group (-OCH3) attached to the aromatic ring, which influences its chemical reactivity and solubility. The incorporation of deuterium enhances its stability and alters its spectroscopic properties, making it useful in various analytical applications, including NMR spectroscopy. The presence of the hydroxyl group (-OH) contributes to its acidity and potential for hydrogen bonding, which can affect its interactions in biological systems or chemical reactions. As a deuterated compound, it is often utilized in studies requiring isotopic labeling, allowing for tracking and tracing in metabolic pathways or reaction mechanisms. Overall, this compound serves as a valuable tool in both synthetic chemistry and analytical research due to its unique isotopic composition and functional groups.

Formula: C₇H₃D₅O₂

InChI: InChI=1S/C7H8O2/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3/i2D,3D,4D,5D/hD

InChI key: LHGVFZTZFXWLCP-MDXQMYCFSA-N

SMILES: [2H]C1=C(C(=C(C(=C1[2H])O[2H])OC)[2H])[2H]

Synonyms:

• 2-Methoxyphen-d4-ol-d
• OD-3,4,5,6-Tetradeuteroguaiacol
• 2-METHOXYPHENOL-3,4,5,6-D4,OD
• 2-Methoxyphenol--d4,OD

2-Methoxyphenol-3,4,5,6-d4,OD

CAS: 20189-11-1, 90-05-1

Formula: CH₃OC₆D₄OD

Purity: 98 atom % D

Color and Shape: Colorless To Yellow Liquid Or Solid

Molecular weight: 129.08381

Ref: 3U-D6184

2-Methoxyphenol-3,4,5,6-d4,OD

Controlled Product

CAS: 20189-11-1

Applications 2-Methoxyphenol-3,4,5,6-d4,OD (CAS# 20189-11-1) is a useful isotopically labeled research compound.

Formula: C₇D₅H₃O₂

Color and Shape: Neat

Molecular weight: 129.168

Ref: TR-M265304