CymitQuimica logo

CAS 201930-16-7

:

Acetamide,2-amino-N-(4-methoxy-2-naphthalenyl)-, hydrochloride (1:1)

Description:
Acetamide, 2-amino-N-(4-methoxy-2-naphthalenyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a building block in organic synthesis and pharmaceutical applications. The presence of the naphthalene moiety suggests that it may exhibit aromatic properties, contributing to its stability and potential interactions in biological systems. The methoxy group enhances its solubility and may influence its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for formulation in various applications. The compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, possibly influencing neurotransmitter systems or other cellular pathways. Overall, this compound's unique structural features and functional groups position it as a candidate for further research in drug development and related fields.
Formula:C13H14N2O2ClH
InChI:InChI=1S/C13H14N2O2.ClH/c1-17-12-7-10(15-13(16)8-14)6-9-4-2-3-5-11(9)12;/h2-7H,8,14H2,1H3,(H,15,16);1H
InChI key:OPTGKLWGIASWQF-UHFFFAOYSA-N
SMILES:COC1=CC(=CC2=CC=CC=C21)NC(=O)CN.Cl
Synonyms:
  • Acetamide,2-amino-N-(4-methoxy-2-naphthalenyl)-, monohydrochloride (9CI)
Found 3 products.