CAS 20205-43-0

6,7-dimethyl-1H-indole-2,3-dione

Description:

6,7-Dimethyl-1H-indole-2,3-dione, also known as 6,7-dimethylindole-2,3-dione, is an organic compound characterized by its indole structure, which features a fused benzene and pyrrole ring. This compound contains two methyl groups at the 6 and 7 positions of the indole ring and two carbonyl groups at the 2 and 3 positions, contributing to its diketone functionality. It is typically a yellow to orange solid, exhibiting moderate solubility in organic solvents. The presence of the carbonyl groups makes it a potential candidate for various chemical reactions, including nucleophilic additions and cycloadditions. Its unique structure allows it to participate in biological activities, making it of interest in medicinal chemistry and research. The compound's CAS number, 20205-43-0, is a unique identifier that facilitates its identification in chemical databases. As with many indole derivatives, it may exhibit interesting pharmacological properties, although specific biological activities would require further investigation.

Formula: C₁₀H₉NO₂

InChI: InChI=1/C10H9NO2/c1-5-3-4-7-8(6(5)2)11-10(13)9(7)12/h3-4H,1-2H3,(H,11,12,13)

SMILES: Cc1ccc2c(c1C)NC(=O)C2=O

Synonyms:

• 1H-indole-2,3-dione, 6,7-dimethyl-

1H-Indole-2,3-dione, 6,7-dimethyl-

CAS: 20205-43-0

Formula: C₁₀H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 175.1840

Ref: IN-DA00280M

6,7-dimethylisatin

CAS: 20205-43-0

6,7-dimethylisatin

Formula: C₁₀H₉NO₂

Purity: ≥98%

Molecular weight: 175.18

Ref: 54-BUP05315

6,7-dimethylisatin

CAS: 20205-43-0

6,7-Dimethylisatin (6,7-dimethyl-1H-indole-2,3-dione) inhibits hGAT3 with IC50 of 108 μM. 6,7-Dimethylisatin also inhibits hBGT1, hGAT2.

Formula: C₁₀H₉NO₂

Purity: 98.98%

Color and Shape: Solid

Molecular weight: 175.18

Ref: TM-T77568

6,7-dimethylisatin

CAS: 20205-43-0

6,7-Dimethylindoline-2,3-dione

Formula: C₁₀H₉NO₂

Purity: 97%

Molecular weight: 175.18

Ref: IN-DG107904

6,7-Dimethyl-1H-indole-2,3-dione

CAS: 20205-43-0

Formula: C₁₀H₉NO₂

Purity: 95.0%

Molecular weight: 175.187

Ref: 10-F060410