CAS 202197-26-0
:3-Chloro-4-[(3-fluorophenyl)methoxy]benzenamine
Description:
3-Chloro-4-[(3-fluorophenyl)methoxy]benzenamine, with the CAS number 202197-26-0, is an organic compound characterized by its aromatic structure, which includes a chloro substituent and a methoxy group attached to a phenyl ring. This compound features a primary amine functional group, which contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions. The presence of the fluorophenyl moiety enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The chlorine atom introduces additional electronic effects, potentially affecting the compound's stability and reactivity. Overall, this compound's unique combination of functional groups and substituents suggests potential utility in pharmaceutical development, particularly in the design of targeted therapies or as intermediates in the synthesis of more complex molecules. Its physical properties, such as solubility and melting point, would depend on the specific interactions of these functional groups in various solvents.
Formula:C13H11ClFNO
InChI:InChI=1S/C13H11ClFNO/c14-12-7-11(16)4-5-13(12)17-8-9-2-1-3-10(15)6-9/h1-7H,8,16H2
InChI key:InChIKey=AYPFEYDGZDPAPE-UHFFFAOYSA-N
SMILES:C(OC1=C(Cl)C=C(N)C=C1)C2=CC(F)=CC=C2
Synonyms:- 3-Chloro-4-(3-fluoro-benzyloxy)-phenylamine
- 3-Chloro-4-(3-fluorobenzyloxy)-aniline
- 3-Chloro-4-[(3-fluorobenzyl)oxy]aniline
- 3-Chloro-4-[(3-fluorophenyl)methoxy]aniline
- 3-Chloro-4-[(3-fluorophenyl)methoxy]benzenamine
- 4-(3-Fluorobenzyloxy)-3-chloroaniline
- Benzenamine, 3-chloro-4-[(3-fluorophenyl)methoxy]-
- [3-Chloro-4-(3-fluorobenzyloxy)phenyl]amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Benzenamine, 3-chloro-4-[(3-fluorophenyl)methoxy]-
CAS:Formula:C13H11ClFNOPurity:98%Color and Shape:SolidMolecular weight:251.6839Lapatinib Impurity 18-d4
CAS:Formula:C13H7D4ClFNOColor and Shape:White To Off-White SolidMolecular weight:255.713-Chloro-4-(3-fluorobenzyloxy)aniline
CAS:Formula:C13H11ClFNOPurity:>98.0%(GC)(T)Color and Shape:White to Gray to Red powder to crystalMolecular weight:251.693-Chloro-4-[(3-fluorobenzyl)oxy]aniline
CAS:3-Chloro-4-[(3-fluorobenzyl)oxy]anilineFormula:C13H11ClFNOPurity:98%Color and Shape:Grey SolidMolecular weight:251.683943-Chloro-4-(3-fluorobenzyloxy)aniline
CAS:Applications 3-Chloro-4-(3-fluorobenzyloxy)aniline is an intermediate in the synthesis of Lapatinib (L175800).
References Petrov, K., et al.: Bioorg. Med. Chem. Lett., 16, 4686 (2006),Formula:C13H11ClFNOColor and Shape:NeatMolecular weight:251.683-Chloro-4-[(3-fluorobenzyl)oxy]aniline
CAS:Formula:C13H11ClFNOPurity:97%Color and Shape:Brown powderMolecular weight:251.693-Chloro-4-(3-fluorobenzyloxy)aniline
CAS:3-Chloro-4-(3-fluorobenzyloxy)aniline is a potent inhibitor of the epidermal growth factor receptor (EGFR), which is a tyrosine kinase that plays an important role in the initiation and progression of cancer. The compound has been shown to inhibit the proliferation of human cancer cell lines, such as breast cancer and prostate cancer, by blocking EGFR signaling. 3-Chloro-4-(3-fluorobenzyloxy)aniline also inhibits the activity of other kinases, such as lapatinib and 2-amino-4-fluorobenzoic acid. This inhibition may be due to its ability to bind to the ATP binding site on these enzymes.Formula:C13H11ClFNOPurity:Min. 95%Color and Shape:PowderMolecular weight:251.68 g/mol







