CAS 20243-59-8
:Luteolin 7-methyl ether
Description:
Luteolin 7-methyl ether, also known by its CAS number 20243-59-8, is a flavonoid compound derived from luteolin, a naturally occurring antioxidant found in various plants. This compound exhibits a yellow crystalline appearance and is soluble in organic solvents such as ethanol and methanol, but has limited solubility in water. Luteolin 7-methyl ether is known for its potential health benefits, including anti-inflammatory, antioxidant, and anticancer properties, which are attributed to its ability to scavenge free radicals and modulate various signaling pathways. It is often studied in the context of herbal medicine and dietary supplements, as it may contribute to the therapeutic effects of plants rich in flavonoids. Additionally, this compound may interact with various biological targets, influencing cellular processes and potentially offering protective effects against chronic diseases. Its stability and reactivity can vary depending on environmental conditions, making it an interesting subject for further research in pharmacology and natural product chemistry.
Formula:C16H12O6
InChI:InChI=1S/C16H12O6/c1-21-9-5-12(19)16-13(20)7-14(22-15(16)6-9)8-2-3-10(17)11(18)4-8/h2-7,17-19H,1H3
InChI key:InChIKey=RRRSSAVLTCVNIQ-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(=C1)C3=CC(O)=C(O)C=C3)=CC(OC)=CC2O
Synonyms:- 2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-methoxy-4H-1-benzopyran-4-one
- 2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-methoxy-4H-chromen-4-one
- 2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-methoxychromen-4-one
- 3′,4′,5-Trihydroxy-7-methoxyflavone
- 3′-Hydroxygenkwanin
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-
- 4H-1-Benzopyran-4-one, 3,5-dihydroxy-2-(4-hydroxyphenyl)-7-methoxy-
- 5,3′,4′-Trihydroxy-7-methoxyflavone
- 7-O-Methylluteolin
- Flavone, 3′,4′,5-trihydroxy-7-methoxy-
- Hydroxygenkwanin
- Hydroxyl Genkwanin
- Luteolin 7-methyl ether
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-
CAS:Formula:C16H12O6Purity:98%Color and Shape:SolidMolecular weight:300.2629Hydroxygenkwanin
CAS:2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-methoxy-4H-chromen-4-oneFormula:C16H12O6Purity:98%Molecular weight:300.26Hydroxygenkwanin
CAS:1.Formula:C16H12O6Purity:98.86% - 99.62%Color and Shape:SolidMolecular weight:300.26Ref: TM-T4S0094
1mg34.00€1mL*10mM (DMSO)50.00€5mg71.00€10mg96.00€25mg149.00€50mg216.00€100mg321.00€200mg475.00€Luteolin 7-methyl ether
CAS:Oxygen-heterocyclic compoundFormula:C16H12O6Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:300.272-(3,4-Dihydroxyphenyl)-5-hydroxy-7-methoxy-4H-chromen-4-one
CAS:Purity:95+%Molecular weight:300.2659912Hydroxygenkwanin
CAS:Hydroxygenkwanin is a type of flavonoid, which is a natural compound extracted from various plant sources, particularly those within the Asteraceae family. It functions predominantly through its ability to modulate multiple signaling pathways, including antioxidant, anti-inflammatory, and apoptosis-inducing activities. Hydroxygenkwanin acts by influencing cellular signaling cascades, enhancing or inhibiting the expression of specific proteins and genes related to cell cycle regulation and immune response.
Formula:C16H12O6Purity:Min. 95%Molecular weight:300.26 g/mol








