CAS 202656-22-2

1,2-Benzene-3,4,5,6-d4-diol-d2

Description:

1,2-Benzene-3,4,5,6-d4-diol-d2, also known as a deuterated form of a benzene derivative, is characterized by the presence of deuterium, a stable isotope of hydrogen, which replaces hydrogen atoms in the molecular structure. This compound features a benzene ring with hydroxyl (-OH) groups at the 1 and 2 positions, and deuterium substitutions at the 3, 4, 5, and 6 positions of the ring. The incorporation of deuterium enhances the compound's stability and alters its physical properties, such as boiling and melting points, compared to its non-deuterated counterparts. Deuterated compounds are often used in NMR spectroscopy and other analytical techniques due to their unique spectral signatures, which facilitate the study of molecular structures and dynamics. Additionally, the presence of multiple hydroxyl groups suggests potential for hydrogen bonding, influencing solubility and reactivity in various chemical environments. Overall, this compound serves as a valuable tool in both research and industrial applications, particularly in fields requiring precise isotopic labeling.

Formula: C₆D₆O₂

InChI: InChI=1S/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H/i1D,2D,3D,4D/hD2

InChI key: YCIMNLLNPGFGHC-UDDMDDBKSA-N

SMILES: [2H]C1=C(C(=C(C(=C1[2H])O[2H])O[2H])[2H])[2H]

Synonyms:

• Pyrogallol-d6

1, 2-DIHYDROXYBENZENE-D6

CAS: 202656-22-2

1, 2-DIHYDROXYBENZENE-D6

Formula: C₆D₆O₂

Molecular weight: 116.15

Ref: 54-DE2541

1,2-Dihydroxybenzene-d6

CAS: 120-80-9, 202656-22-2

Formula: C₆D₄(OD)₂

Purity: 98 atom % D

Color and Shape: White-Tan Solid

Molecular weight: 116.07444

Ref: 3U-D5290

Catechol-d6

Controlled Product

CAS: 202656-22-2

Applications A labelled form of Catechol (C215175) and has been used in the characterization of surface inclusion of unidirectional molecular motors in hexagonal tris(o-phenylene)cyclotriphosphazene.
References Kaleta, J.; et al.: J. Am. Chem. Soc., 139, 10486 (2017).

Formula: C₆D₆O₂

Color and Shape: Neat

Molecular weight: 116.15

Ref: TR-C215178