CymitQuimica logo

CAS 20271-35-6

:

5-amino-1-benzyl-1H-1,2,3-triazole-4-carbonitrile

Description:
5-amino-1-benzyl-1H-1,2,3-triazole-4-carbonitrile is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features an amino group (-NH2) and a benzyl group (-C6H5CH2) attached to the triazole, contributing to its potential biological activity and solubility properties. The presence of a carbonitrile group (-C≡N) at the 4-position of the triazole enhances its reactivity and may influence its interactions in various chemical environments. This compound is of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. Its unique structure allows for various synthetic modifications, making it a versatile compound in research. Additionally, the presence of multiple functional groups suggests that it may exhibit diverse chemical behavior, including hydrogen bonding and coordination with metal ions, which can be explored in various applications.
Formula:C10H9N5
InChI:InChI=1/C10H9N5/c11-6-9-10(12)15(14-13-9)7-8-4-2-1-3-5-8/h1-5H,7,12H2
SMILES:c1ccc(cc1)Cn1c(c(C#N)nn1)N
Synonyms:
  • 1H-[1,2,3]Triazole-4-carbonitrile, 5-amino-1-benzyl-
  • 1H-1,2,3-Triazole-4-carbonitrile, 5-amino-1- (phenylmethyl)-
Found 2 products.