CymitQuimica logo

CAS 20274-69-5

:

(4-Fluoro-3-nitrophenyl)methanol

Description:
(4-Fluoro-3-nitrophenyl)methanol is an organic compound characterized by the presence of a phenolic structure with both a fluorine and a nitro group substituted on the aromatic ring. The compound features a hydroxymethyl group (-CH2OH) attached to the aromatic system, which contributes to its reactivity and potential applications in various chemical reactions. The fluorine atom, being electronegative, can influence the compound's electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. The nitro group, known for its electron-withdrawing properties, can further modify the compound's reactivity and stability. This compound may be utilized in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its physical properties, such as solubility and melting point, would depend on the specific interactions of the functional groups present. Safety data should be consulted for handling, as compounds with nitro groups can be sensitive and potentially hazardous. Overall, (4-Fluoro-3-nitrophenyl)methanol is a versatile compound with significant implications in chemical research and industry.
Formula:C7H6FNO3
InChI:InChI=1/C7H6FNO3/c8-6-2-1-5(4-10)3-7(6)9(11)12/h1-3,10H,4H2
InChI key:MKWJZTFMDWSRIH-UHFFFAOYSA-N
SMILES:c1cc(c(cc1CO)N(=O)=O)F
Synonyms:
  • (4-Fluor-3-nitrophenyl)methanol
  • Benzenemethanol, 4-fluoro-3-nitro-
  • 4-Fluoro-3-nitrobenzyl alcohol
Found 6 products.