CAS 202865-64-3

Benzaldehyde, 4-bromo-2-fluoro-, oxime

Description:

Benzaldehyde, 4-bromo-2-fluoro-, oxime is an organic compound characterized by the presence of a benzaldehyde moiety substituted with both a bromine and a fluorine atom, along with an oxime functional group. The oxime group, which is derived from the reaction of an aldehyde with hydroxylamine, features a nitrogen atom double-bonded to an oxygen atom and single-bonded to a carbon atom from the benzaldehyde structure. This compound typically exhibits properties associated with aromatic aldehydes, such as volatility and a distinctive odor. The presence of the bromine and fluorine substituents can influence its reactivity, polarity, and solubility in various solvents. Additionally, the compound may participate in various chemical reactions, including nucleophilic additions and substitutions, due to the electrophilic nature of the carbonyl carbon in the oxime. Its unique structure and functional groups make it of interest in synthetic organic chemistry and potentially in medicinal chemistry for the development of new pharmaceuticals.

Formula: C₇H₅BrFNO

InChI: InChI=1S/C7H5BrFNO/c8-6-2-1-5(4-10-11)7(9)3-6/h1-4,11H

InChI key: InChIKey=DHBUKMPUUDCJTH-UHFFFAOYSA-N

SMILES: C(=NO)C1=C(F)C=C(Br)C=C1

Synonyms:

• 2-Fluoro-4-bromobenzaldehyde oxime
• 4-Bromo-2-fluorobenzaldehyde oxime
• Benzaldehyde, 4-bromo-2-fluoro-, oxime

4-Bromo-2-fluorobenzaldoxime

CAS: 202865-64-3

4-Bromo-2-fluorobenzaldoxime

Formula: C₇H₅BrFNO

Purity: 97%

Color and Shape: White to brown. Solid

Molecular weight: 218.0231

Ref: 54-PC7368

Benzaldehyde, 4-bromo-2-fluoro-, oxime

CAS: 202865-64-3

Formula: C₇H₅BrFNO

Purity: 95%

Molecular weight: 218.0231

Ref: IN-DA0028HI

4-Bromo-2-fluorobenzaldoxime

CAS: 202865-64-3

4-Bromo-2-fluorobenzaldoxime is a fine chemical that is used as a building block in the synthesis of complex molecules. It is also an intermediate in the production of pharmaceuticals, research chemicals, and other specialty chemicals. 4-Bromo-2-fluorobenzaldoxime has a CAS number of 202865-64-3 and is a useful reagent for organic synthesis. It can be used to produce high quality compounds with versatile building blocks.

Formula: C₇H₅BrFNO

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 218.02 g/mol

Ref: 3D-FB30110

(E)-4-bromo-2-fluorobenzaldehyde oxime

CAS: 202865-64-3

Purity: ≥95%

Molecular weight: 218.0249939

Ref: 10-F771835