CymitQuimica logo

CAS 203000-48-0

:

(s,s)-1,2-bis[(tert-butyl)methylphosphino]ethane bis(borane)

Description:
(s,s)-1,2-bis[(tert-butyl)methylphosphino]ethane bis(borane), with the CAS number 203000-48-0, is a chemical compound characterized by its unique structure that includes both phosphine and borane functionalities. This compound features a chiral backbone, which contributes to its stereochemical properties, specifically the (s,s) configuration. The presence of tert-butyl groups enhances its steric bulk, making it a bulky ligand that can stabilize metal complexes in coordination chemistry. The bis(borane) component indicates that it contains two borane units, which can participate in various chemical reactions, including Lewis acid-base interactions. This compound is often utilized in organometallic chemistry and catalysis, particularly in reactions involving transition metals. Its phosphine groups are known for their strong donor properties, making it effective in stabilizing low-valent metal species. Overall, this compound is significant in synthetic chemistry for its ability to facilitate various transformations and its role in the development of new catalytic systems.
Formula:C12H34B2P2
InChI:InChI=1/C12H28P2.2BH3/c1-11(2,3)13(7)9-10-14(8)12(4,5)6;;/h9-10H2,1-8H3;2*1H3/t13-,14-;;/m0../s1
InChI key:VQQZJPKTKBTFHB-AXEKQOJOSA-N
SMILES:CC(C)(C)P(C)CCP(C)C(C)(C)C.B.B
Found 2 products.