CAS 20302-26-5

Ethylbenzene-2,3,4,5,6-d5

Description:

Ethylbenzene-2,3,4,5,6-d5 is a deuterated form of ethylbenzene, where five hydrogen atoms in the ethylbenzene molecule are replaced with deuterium, a stable isotope of hydrogen. This compound is characterized by its aromatic structure, consisting of a benzene ring bonded to an ethyl group. The presence of deuterium enhances its utility in various scientific applications, particularly in nuclear magnetic resonance (NMR) spectroscopy, where it serves as a useful solvent or reference compound due to its distinct spectral properties. Ethylbenzene itself is a colorless liquid with a sweet odor, and it is primarily used in the production of styrene, which is a precursor for various plastics and resins. The deuterated version, while retaining similar physical and chemical properties to its non-deuterated counterpart, may exhibit differences in reaction kinetics and thermodynamic properties due to the isotope effect. Ethylbenzene-2,3,4,5,6-d5 is typically handled with standard safety precautions, as it can be flammable and may pose health risks upon exposure.

Formula: C₈H₅D₅

InChI: InChI=1/C8H10/c1-2-8-6-4-3-5-7-8/h3-7H,2H2,1H3/i1D3,2D2

InChI key: YNQLUTRBYVCPMQ-ZBJDZAJPSA-N

SMILES: C(C(c1ccccc1)([2H])[2H])([2H])([2H])[2H]

Synonyms:

• Ethylbenzene-ring-d5
• (~2~H_5_)ethylbenzene

Ethylbenzene-2,3,4,5,6-d5

CAS: 100-41-4, 20302-26-5

Formula: C₆D₅CH₂CH₃

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 111.10963

Ref: 3U-D1903

Ethylbenzene-2,3,4,5,6-d5

Controlled Product

CAS: 20302-26-5

Applications Ethylbenzene-2,3,4,5,6-d5 (CAS# 20302-26-5) is a useful isotopically labeled research compound.

Formula: C₈D₅H₅

Color and Shape: Neat

Molecular weight: 111.1958

Ref: TR-E899752