CAS 20312-37-2
:D-Leucic acid
Description:
D-Leucic acid, with the CAS number 20312-37-2, is an amino acid derivative that is a structural isomer of leucine, an essential branched-chain amino acid. It features a carboxylic acid functional group (-COOH) and an amino group (-NH2), characteristic of amino acids, which allows it to participate in various biochemical processes. D-Leucic acid is known for its role in protein synthesis and metabolism, similar to its L-isomer counterpart. It is typically found in a crystalline form and is soluble in water, making it suitable for various applications in biochemistry and nutrition. The D-configuration indicates that the molecule has a specific spatial arrangement of its atoms, which can influence its biological activity and interactions with enzymes and receptors. While D-amino acids are less common in nature compared to their L-forms, they can play unique roles in certain biological systems and may have potential therapeutic applications. Overall, D-Leucic acid is an important compound in the study of amino acids and their functions in living organisms.
Formula:C6H12O3
InChI:InChI=1S/C6H12O3/c1-4(2)3-5(7)6(8)9/h4-5,7H,3H2,1-2H3,(H,8,9)/t5-/m1/s1
InChI key:InChIKey=LVRFTAZAXQPQHI-RXMQYKEDSA-N
SMILES:[C@@H](CC(C)C)(C(O)=O)O
Synonyms:- (-)-2-Hydroxyisocaproic acid
- (-)-α-Hydroxyisocaproic acid
- (R)-2-Hydroxy-4-methylpentanoic acid
- (R)-2-Hydroxyisocaproic acid
- (R)-2-hydroxy-4-methyl-Pentanoic acid
- (R)-Leucic acid
- <span class="text-smallcaps">D</span>-2-Hydroxy-4-methylpentanoic acid
- <span class="text-smallcaps">D</span>-2-Hydroxy-4-methylvaleric acid
- <span class="text-smallcaps">D</span>-2-Hydroxyisocaproic acid
- <span class="text-smallcaps">D</span>-Leucic acid
- <span class="text-smallcaps">D</span>-α-Hydroxyisocaproic acid
- Pentanoic acid, 2-hydroxy-4-methyl-, (2R)-
- Pentanoic acid, 2-hydroxy-4-methyl-, (R)-
- Valeric acid, 2-hydroxy-4-methyl-, <span class="text-smallcaps">D</span>-
- (2R)-2-Hydroxy-4-methylpentanoic acid
- Valeric acid, 2-hydroxy-4-methyl-, D-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
D-α-Hydroxyisocaproic acid
CAS:Bachem ID: 4026246.
Formula:C6H12O3Purity:> 99%Color and Shape:White PowderMolecular weight:132.16(R)-2-Hydroxy-4-methylpentanoic acid
CAS:Formula:C6H12O3Purity:95%Color and Shape:SolidMolecular weight:132.1577Ref: IN-DA0028ON
500gTo inquire100mg34.00€250mg40.00€1g51.00€5g114.00€10g200.00€25g283.00€100g559.00€(R)-Leucic acid
CAS:(R)-Leucic acid (D-HICA) is an active leucine metabolite; upregulates CD36; promotes fatty acid absorption; lipid metabolism research tool.Formula:C6H12O3Color and Shape:White SolidMolecular weight:132.158(R)-Leucic acid
CAS:(R)-2-Hydroxy-4-methylpentanoic acidFormula:C6H12O3Purity:95%Molecular weight:132.16(R)-2-Hydroxy-4-methylpentanoic acid
CAS:(R)-2-Hydroxy-4-methylpentanoic acidFormula:C6H12O3Purity:95%Color and Shape:SolidMolecular weight:132.15768(R)-2-Hydroxy-4-methylpentanoic acid
CAS:Formula:C6H12O3Purity:97%Color and Shape:SolidMolecular weight:132.159





