CymitQuimica logo

CAS 20317-25-3

:

5-amino-1-phenyl-1H-1,2,3-triazole-4-carboxamide

Description:
5-amino-1-phenyl-1H-1,2,3-triazole-4-carboxamide is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features an amino group and a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of the phenyl group enhances its aromatic properties, which can influence its solubility and reactivity. Typically, compounds like this may exhibit various biological activities, making them of interest in pharmaceutical research. The triazole moiety is known for its role in medicinal chemistry, particularly in the development of antifungal and anticancer agents. Additionally, the compound's structure suggests it may participate in hydrogen bonding due to the amino and carboxamide groups, which could affect its interactions with biological targets. Overall, 5-amino-1-phenyl-1H-1,2,3-triazole-4-carboxamide is a versatile compound with potential applications in drug development and other fields of chemistry.
Formula:C9H9N5O
InChI:InChI=1/C9H9N5O/c10-8-7(9(11)15)12-13-14(8)6-4-2-1-3-5-6/h1-5H,10H2,(H2,11,15)
SMILES:c1ccc(cc1)n1c(c(C(=N)O)nn1)N
Found 2 products.