CymitQuimica logo

CAS 20329-91-3

:

Benzene-d5, butyl-(8CI,9CI)

Description:
Benzene-d5, butyl-(8CI,9CI) is a deuterated derivative of butylbenzene, where five hydrogen atoms in the benzene ring are replaced with deuterium isotopes. This compound is characterized by its aromatic structure, which contributes to its stability and unique chemical properties. The presence of deuterium enhances its mass, making it useful in various applications, particularly in NMR spectroscopy, where it serves as a valuable internal standard due to its distinct spectral characteristics. The butyl group attached to the benzene ring influences the compound's solubility and reactivity, making it more hydrophobic compared to its non-deuterated counterparts. Additionally, the compound is typically used in research and industrial applications, including organic synthesis and as a solvent in chemical reactions. Its CAS number, 20329-91-3, allows for easy identification and reference in chemical databases. Overall, Benzene-d5, butyl-(8CI,9CI) is a significant compound in the field of organic chemistry, particularly in studies involving isotopic labeling and reaction mechanisms.
Formula:C10H9D5
InChI:InChI=1S/C10H14/c1-2-3-7-10-8-5-4-6-9-10/h4-6,8-9H,2-3,7H2,1H3/i4D,5D,6D,8D,9D
InChI key:OCKPCBLVNKHBMX-SPUMIAEJSA-N
SMILES:[2H]C1=C(C(=C(C(=C1[2H])[2H])CCCC)[2H])[2H]
Synonyms:
  • N-Butylbenzene-2,3,4,5,6-D5
Found 2 products.