CymitQuimica logo

CAS 203314-33-4

:

methyl 2-(5-bromo-2-chlorophenyl)acetate

Description:
Methyl 2-(5-bromo-2-chlorophenyl)acetate is an organic compound characterized by its ester functional group, which is derived from the reaction of acetic acid and a substituted phenol. This compound features a bromine and chlorine substituent on the aromatic ring, contributing to its unique chemical properties and reactivity. The presence of these halogens can influence the compound's polarity, solubility, and potential for participating in electrophilic aromatic substitution reactions. Methyl 2-(5-bromo-2-chlorophenyl)acetate is typically a colorless to pale yellow liquid, exhibiting moderate volatility and a distinct odor. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic aromatic structure. This compound is often used in synthetic organic chemistry as an intermediate for the preparation of various pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this substance, as it may pose health risks due to the presence of halogenated groups.
Formula:C9H8BrClO2
InChI:InChI=1S/C9H8BrClO2/c1-13-9(12)5-6-4-7(10)2-3-8(6)11/h2-4H,5H2,1H3
InChI key:GINLBXIFGQVBHL-UHFFFAOYSA-N
SMILES:COC(=O)CC1=C(C=CC(=C1)Br)Cl
Synonyms:
  • 5-Bromo-2-chlorophenylacetic-acid-methyl-ester
Found 4 products.