CymitQuimica logo

CAS 2034-56-2

:

Triethyl 4-phosphonocrotonate, (4-Phosphonocrotonic ac

Description:
Triethyl 4-phosphonocrotonate, also known as 4-phosphonocrotonic acid, is an organophosphorus compound characterized by the presence of a phosphonate group and a crotonate moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar organic solvents, which facilitates its use in various chemical reactions. The presence of the phosphonate group imparts unique reactivity, making it a valuable intermediate in organic synthesis, particularly in the preparation of phosphonates and other phosphorus-containing compounds. Triethyl 4-phosphonocrotonate is often utilized in the synthesis of biologically active molecules and can serve as a building block in the development of agrochemicals and pharmaceuticals. Additionally, it may exhibit specific biological activities due to its structural features, although detailed studies on its biological properties may vary. As with many organophosphorus compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C14H28O3
InChI:InChI=1/C14H28O3/c1-2-10-13(15)11-8-6-4-3-5-7-9-12-14(16)17/h13,15H,2-12H2,1H3,(H,16,17)
InChI key:DMCZWEUMVOFXBT-UHFFFAOYSA-N
SMILES:CCCC(CCCCCCCCCC(=O)O)O
Synonyms:
  • 11-Hydroxytetradecanoic acid
  • Tetradecanoic acid, 11-hydroxy-
Found 3 products.