CAS 20353-93-9
:gold'S
Description:
The chemical substance referred to as "gold'S" with the CAS number 20353-93-9 is a specific form of gold, often associated with its applications in various fields, including electronics and medicine. Gold is a noble metal known for its excellent conductivity, resistance to corrosion, and biocompatibility, making it highly valuable in both industrial and biomedical applications. It typically appears as a bright yellow metal in its elemental form and is characterized by its malleability and ductility, allowing it to be easily shaped into thin sheets or drawn into wires. In terms of chemical properties, gold is relatively inert, not reacting with most acids, although it can be dissolved in aqua regia, a mixture of hydrochloric and nitric acids. The specific characteristics of "gold'S" may also include its particle size, surface area, and any functionalization that enhances its properties for particular applications. Overall, gold's unique combination of physical and chemical properties contributes to its widespread use across various industries.
Formula:C6H14ClN3
InChI:InChI=1/C6H14N3.ClH/c1-8(2)5-7-6-9(3)4;/h5-6H,1-4H3;1H/q+1;/p-1
Synonyms:- N-({[(1E)-(dimethylamino)methylidene]amino}methylidene)-N-methylmethanaminium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Gold's Reagent
CAS:Formula:C6H14ClN3Purity:>97.0%(T)(HPLC)Color and Shape:Light orange to Yellow to Green powder to crystalMolecular weight:163.65N-((((Dimethylamino)Methylene)Amino)Methylene)-N-Methylmethanaminium Chloride
CAS:N-((((Dimethylamino)Methylene)Amino)Methylene)-N-Methylmethanaminium ChlorideFormula:C6H14ClN3Purity:95%Molecular weight:163.65(([(Dimethylamino)methylidene]amino)methylidene)dimethylazanium chloride
CAS:Formula:C6H14ClN3Purity:95%Color and Shape:SolidMolecular weight:163.6485Gold's Reagent
CAS:N-((((Dimethylamino)methylene)amino)methylene)-N-methylmethanaminium chlorideFormula:C6H14ClN3Purity:95%Molecular weight:163.65




