CymitQuimica logo

CAS 20356-45-0

:

3-(1H-indol-3-yl)-3-oxopropanenitrile

Description:
3-(1H-indol-3-yl)-3-oxopropanenitrile, with the CAS number 20356-45-0, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a propanenitrile group, indicating the presence of a cyano group (-C≡N) attached to a three-carbon chain that includes a ketone functional group (3-oxo). The indole moiety contributes to its potential biological activity, as indole derivatives are known for their roles in various pharmacological applications. The presence of the cyano group may enhance its reactivity and solubility in organic solvents. The compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its synthesis often involves multi-step organic reactions, and it may be of interest in medicinal chemistry for the development of new therapeutic agents. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C11H8N2O
InChI:InChI=1/C11H8N2O/c12-6-5-11(14)9-7-13-10-4-2-1-3-8(9)10/h1-4,7,13H,5H2
InChI key:KSKBLDDGNWKWKN-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)c(c[nH]2)C(=O)CC#N
Synonyms:
  • 1H-indole-3-propanenitrile, beta-oxo-
  • 3-(1H-Indol-3-yl)-3-oxo-propionitrile
Found 4 products.