CAS 20357-25-9
:DMNB
Description:
DMNB, or 2,3-dimethyl-2,3-dinitrobutane, is a chemical compound characterized by its unique structure and properties. It is a nitroalkane, which means it contains nitro groups (-NO2) attached to a carbon chain. DMNB is typically a yellow crystalline solid at room temperature and is known for its high density and stability under normal conditions. It is primarily used in the field of explosives and as a chemical marker in various applications, including detection and analysis. The compound is relatively insensitive to shock and friction, making it safer to handle compared to other high-energy materials. DMNB is also soluble in organic solvents, which facilitates its use in various chemical processes. Its environmental impact and toxicity are subjects of ongoing research, as with many nitro compounds, due to potential effects on human health and ecosystems. Overall, DMNB is notable for its applications in both military and civilian contexts, particularly in the development of explosives and as a tracer in analytical chemistry.
Formula:C9H9NO5
InChI:InChI=1S/C9H9NO5/c1-14-8-3-6(5-11)7(10(12)13)4-9(8)15-2/h3-5H,1-2H3
InChI key:InChIKey=YWSPWKXREVSQCA-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=O)C=C(OC)C(OC)=C1
Synonyms:- 2-Nitro-4,5-dimethoxybenzaldehyde
- 3,4-Dimethoxy-6-nitrobenzaldehyde
- 4,5-Dimethoxy-2-nitrobenzaldehyde
- 4-O-Methyl-6-nitrovanillin
- Benzaldehyde, 4,5-dimethoxy-2-nitro-
- NSC 65590
- Veratraldehyde, 6-nitro-
- 6-Nitroveratraldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
6-Nitroveratraldehyde
CAS:Formula:C9H9NO5Purity:>85.0%(GC)Color and Shape:White to Light yellow to Green powder to crystalMolecular weight:211.176-Nitroveratraldehyde, 96%
CAS:6-Nitroveratraldehyde has been used in the preparation of no-carrier-added 6-18F-fluoro-L-dopa, fundamental tracer for cerebral positron emission tomography studies of dopaminergic system in humans and o-nitroaryl-bis(5-methylfur-2-yl)methanes, versatile synthons for the synthesis of nitrogen-contaFormula:C9H9NO5Purity:96%Color and Shape:Powder, Pale yellow to yellowMolecular weight:211.17Benzaldehyde, 4,5-dimethoxy-2-nitro-
CAS:Formula:C9H9NO5Purity:96%Color and Shape:SolidMolecular weight:211.17154,5-Dimethoxy-2-nitrobenzaldehyde
CAS:4,5-Dimethoxy-2-nitrobenzaldehydeFormula:C9H9NO5Purity:97%Color and Shape:Solid-PowderMolecular weight:211.17145DMNB
CAS:DMNB (6-Nitroveratraldehyde) is DNA-dependent protein kinase (DNA-PK) inhibitor, an enzyme involved in the NHEJ pathway of DSB repair in human cells.Formula:C9H9NO5Purity:97.87%Color and Shape:Yellow SolidMolecular weight:211.173,4-Dimethoxy-6-nitrobenzaldehyde
CAS:3,4-Dimethoxy-6-nitrobenzaldehyde is a chemical compound that has been synthesized by the reaction of 3,4-dimethoxybenzaldehyde and nitric acid. The asymmetric synthesis of 3,4-Dimethoxy-6-nitrobenzaldehyde starts with the preparation of the corresponding ester, which is then reacted with nitric acid to produce the desired product. The chemical structure of 3,4-Dimethoxy-6-nitrobenzaldehyde consists of three aromatic rings: a benzene ring fused to a phenyl ring and a pyridine ring. This chemical can be used as an intermediate in the synthesis of epidermal growth factor (EGF). It also has been shown to bind to toll like receptor 4 (TLR4), which activates NFκB signaling pathway and induces apoptosis in monocytes.Formula:C9H9NO5Purity:Min. 95 Area-%Color and Shape:White Yellow PowderMolecular weight:211.17 g/mol







