CymitQuimica logo

CAS 20366-59-0

:

1-bromo-5-methylnaphthalene

Description:
1-Bromo-5-methylnaphthalene is an organic compound characterized by the presence of a bromine atom and a methyl group attached to a naphthalene ring system. It belongs to the class of polycyclic aromatic hydrocarbons and is typically represented by the molecular formula C11H9Br. The compound exhibits a fused bicyclic structure, which contributes to its stability and unique chemical properties. It is generally a colorless to pale yellow liquid or solid, depending on the temperature and purity. 1-Bromo-5-methylnaphthalene is known for its moderate solubility in organic solvents, such as ethanol and ether, while being less soluble in water due to its hydrophobic nature. The presence of the bromine atom makes it a useful intermediate in organic synthesis, particularly in electrophilic substitution reactions. Additionally, it may exhibit interesting physical properties, such as fluorescence, and can be utilized in various applications, including materials science and pharmaceuticals. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C11H9Br
InChI:InChI=1/C11H9Br/c1-8-4-2-6-10-9(8)5-3-7-11(10)12/h2-7H,1H3
InChI key:QFRWNUJVZXCUJG-UHFFFAOYSA-N
SMILES:Cc1cccc2c1cccc2Br
Found 2 products.