CymitQuimica logo

CAS 203799-82-0

:

H-Ala-OAll.HCl

Description:
H-Ala-OAll.HCl, also known as hydrochloride of N-(2-(2-(2-amino-4-methylpentanoyl)amino)-2-oxoethyl)-L-alanine, is a synthetic compound that belongs to the class of amino acids and their derivatives. It features an L-alanine backbone, which is a non-essential amino acid commonly found in proteins. The presence of the hydrochloride (HCl) indicates that the compound is in its salt form, which often enhances its solubility in water and stability. This compound may be utilized in various biochemical applications, including peptide synthesis and as a building block in drug development. Its structure includes functional groups that can participate in various chemical reactions, making it versatile in synthetic chemistry. As with many amino acid derivatives, it may exhibit properties such as chirality, which is significant in biological systems. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C6H12ClNO2
InChI:InChI=1S/C6H11NO2.ClH/c1-3-4-9-6(8)5(2)7;/h3,5H,1,4,7H2,2H3;1H/t5-;/m0./s1
InChI key:CRXONUAGIIJRTQ-JEDNCBNOSA-N
SMILES:C[C@@H](C(=O)OCC=C)N.Cl
Found 2 products.