CAS 204191-43-5
:3-Amino-4,4-dimethylpentanoic acid
Description:
3-Amino-4,4-dimethylpentanoic acid, identified by its CAS number 204191-43-5, is an amino acid derivative characterized by the presence of an amino group (-NH2) and a carboxylic acid group (-COOH) within its structure. This compound features a branched aliphatic chain, specifically a pentanoic acid backbone with two methyl groups attached to the fourth carbon, contributing to its unique properties. It is typically a white to off-white crystalline solid and is soluble in water due to the polar nature of its functional groups. The amino group allows it to participate in various biochemical reactions, making it relevant in fields such as pharmaceuticals and biochemistry. Its structural characteristics may influence its role as a potential building block in peptide synthesis or as a ligand in coordination chemistry. Additionally, the presence of the amino and carboxylic acid groups suggests that it can act as both an acid and a base, exhibiting zwitterionic behavior in solution.
Formula:C7H15NO2
InChI:InChI=1S/C7H15NO2/c1-7(2,3)5(8)4-6(9)10/h5H,4,8H2,1-3H3,(H,9,10)
InChI key:InChIKey=MIMSUZKTGRXZNZ-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(C(C)(C)C)N
Synonyms:- Dl-3-T-Butyl-Beta-Alanine
- Pentanoic acid, 3-amino-4,4-dimethyl-
- (±)-3-Amino-4,4-dimethylpentanoic acid
- 3-Amino-4,4-dimethylpentanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Amino-4,4-Dimethylpentanoic acid
CAS:3-Amino-4,4-Dimethylpentanoic acidFormula:C7H15NO2Purity:97%Molecular weight:145.2DL-3-t-Butyl-beta-alanine
CAS:DL-3-t-Butyl-beta-alanine is a chiral amino acid that has a stereogenic center at the alpha carbon. The molecule has two enantiomers, which are mirror images of each other. The most common form is the levorotatory (L) form. This product is a racemate of L and D forms and cannot be used for enantioseparation. It can be used as an analyte in sequence optimization or for chiral chromatography. The optimal efficiency for this product is 100%.
Formula:C7H15NO2Purity:Min. 95%Molecular weight:145.2 g/mol




