CAS 20422-13-3
:1-benzylazepane
Description:
1-Benzylazepane is a cyclic amine characterized by a seven-membered ring structure containing a nitrogen atom. Its molecular formula typically includes carbon, hydrogen, and nitrogen, reflecting its composition as an amine derivative. The presence of the benzyl group, which is a phenyl group attached to a methylene (-CH2-) bridge, contributes to its aromatic properties and can influence its reactivity and interactions with other substances. 1-Benzylazepane is generally a colorless to pale yellow liquid, exhibiting moderate solubility in organic solvents while being less soluble in water due to its hydrophobic benzyl group. The nitrogen atom in the azepane ring can participate in hydrogen bonding, which may affect its boiling point and other physical properties. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex chemical structures. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C13H19N
InChI:InChI=1/C13H19N/c1-2-7-11-14(10-6-1)12-13-8-4-3-5-9-13/h3-5,8-9H,1-2,6-7,10-12H2
Synonyms:- 1H-Azepine, hexahydro-1-(phenylmethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Benzylazepane
CAS:Benzylazepane is a triacetoxyborohydride that can be used for the reductive amination of aldehydes to form amines. Benzylazepane has been shown to react with sodium triacetoxyborohydride and amines to produce acrylonitrile, which is useful in the synthesis of polymers. The reductive amination of benzaldehyde with ethyl cyanoacetate forms acrylonitrile and acetaldehyde, which is then oxidized using ozonolysis. This reaction produces nitroethane, nitromethane, and acrylamide. Benzylazepane is also used in the synthesis of nature-inspired molecules such as polysaccharides and nucleotides.
Formula:C13H19NPurity:Min. 95%Molecular weight:189.3 g/mol




