CAS 204244-82-6

N-TETRADECYL-D29-AMINE

Description:

N-Tetradecyl-D29-amine, with the CAS number 204244-82-6, is a deuterated alkyl amine characterized by a long hydrophobic tetradecyl chain and a primary amine functional group. The presence of deuterium (D29) indicates that the molecule contains deuterium isotopes, which can be used in various applications, including tracer studies in chemical and biological research. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature, and is soluble in organic solvents while being less soluble in water due to its long hydrocarbon chain. N-Tetradecyl-D29-amine exhibits surfactant properties, making it useful in formulations for detergents, emulsifiers, and dispersants. Additionally, its unique isotopic labeling allows for enhanced analytical techniques, such as nuclear magnetic resonance (NMR) spectroscopy, facilitating the study of reaction mechanisms and molecular interactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₄H₂D₂₉N

InChI: InChI=1S/C14H31N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15/h2-15H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2,14D2

InChI key: PLZVEHJLHYMBBY-AUFKXYATSA-N

SMILES: [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N

Synonyms:

• N-TETRADECYL-D29-AMINE
• N-TETRADECYLAMINE (D29)

n-Tetradecyl-d29-amine

CAS: 2016-42-4, 204244-82-6

Formula: CD₃(CD₂)₁₃NH₂

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 242.42768

Ref: 3U-D6249

n-Tetradecyl-d29-amine

Controlled Product

CAS: 204244-82-6

Applications n-Tetradecyl-d29-amine (CAS# 204244-82-6) is a useful isotopically labeled research compound.

Formula: C₁₄D₂₉H₂N

Color and Shape: Neat

Molecular weight: 242.581

Ref: TR-T291531