CymitQuimica logo

CAS 204316-01-8

:

Trimethyl(nonafluorobutyl)silane

Description:
Trimethyl(nonafluorobutyl)silane is a silane compound characterized by the presence of a silicon atom bonded to three methyl groups and a nonafluorobutyl group. This compound is notable for its unique fluorinated alkyl chain, which imparts distinct properties such as low surface energy and hydrophobicity, making it useful in various applications, including surface modification and as a potential precursor in the synthesis of fluorinated materials. The presence of fluorine atoms enhances thermal and chemical stability, while the silane functionality allows for bonding to various substrates, including metals and glass. Trimethyl(nonafluorobutyl)silane is typically used in the production of coatings, adhesives, and sealants, where its properties can improve performance and durability. Additionally, due to its fluorinated nature, it may exhibit low volatility and resistance to degradation, making it suitable for use in harsh environments. Safety considerations should be taken into account, as fluorinated compounds can have specific environmental and health impacts.
Formula:C7H9F9Si
InChI:InChI=1S/C7H9F9Si/c1-17(2,3)7(15,16)5(10,11)4(8,9)6(12,13)14/h1-3H3
InChI key:YHSOLWOJHMOEFX-UHFFFAOYSA-N
SMILES:C[Si](C)(C)C(C(C(C(F)(F)F)(F)F)(F)F)(F)F
Synonyms:
  • Trimethyl(nonafluorobutyl)silane
  • Trimethyl(perfluorobutyl)silane
  • Silane, trimethyl(nonafluorobutyl)-
Found 4 products.