CymitQuimica logo

CAS 204320-51-4

:

4-(9H-Fluoren-9-ylmethyl) 3,4-morpholinedicarboxylate

Description:
4-(9H-Fluoren-9-ylmethyl) 3,4-morpholinedicarboxylate is an organic compound characterized by its complex structure, which includes a fluorenylmethyl group and a morpholine ring with two carboxylate functional groups. This compound typically exhibits properties such as moderate solubility in organic solvents, which is common for compounds containing aromatic systems and polar functional groups. The presence of the morpholine moiety suggests potential for hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the fluorenyl group contributes to the compound's stability and may impart unique optical properties, making it of interest in various applications, including pharmaceuticals and materials science. The compound's molecular structure allows for potential applications in drug design, particularly in the development of biologically active molecules. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this substance would need to be assessed through appropriate studies.
Formula:C20H19NO5
InChI:InChI=1S/C20H19NO5/c22-19(23)18-12-25-10-9-21(18)20(24)26-11-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,17-18H,9-12H2,(H,22,23)
InChI key:InChIKey=CJVIYWXADATNKP-UHFFFAOYSA-N
SMILES:C(OC(=O)N1C(C(O)=O)COCC1)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:
  • 4-(9H-Fluoren-9-ylmethyl) 3,4-morpholinedicarboxylate
  • 3,4-Morpholinedicarboxylic acid, 4-(9H-fluoren-9-ylmethyl) ester
Found 5 products.