CymitQuimica logo

CAS 20445-88-9

:

Tributyl(methyl)phosphonium dimethyl phosphate

Description:
Tributyl(methyl)phosphonium dimethyl phosphate, with the CAS number 20445-88-9, is an ionic liquid that exhibits unique characteristics due to its phosphonium cation and phosphate anion structure. This compound is typically colorless to pale yellow and has a relatively low melting point, which allows it to remain liquid at room temperature. It is known for its high thermal stability and low volatility, making it suitable for various applications in chemical processes. The presence of the tributyl groups contributes to its hydrophobic nature, while the dimethyl phosphate anion imparts some degree of polarity. This combination results in a substance that can dissolve a wide range of organic and inorganic materials. Additionally, it has been studied for its potential use in extraction processes, catalysis, and as a solvent in various chemical reactions. Its ionic nature also suggests potential applications in electrochemistry and as a medium for ionic conductivity. Overall, tributyl(methyl)phosphonium dimethyl phosphate is a versatile compound with promising applications in both industrial and research settings.
Formula:C15H36O4P2
InChI:InChI=1S/C13H30P.C2H7O4P/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;1-5-7(3,4)6-2/h5-13H2,1-4H3;1-2H3,(H,3,4)/q+1;/p-1
InChI key:LSDYBCGXPCFFNM-UHFFFAOYSA-M
SMILES:CCCC[P+](C)(CCCC)CCCC.COP(=O)([O-])OC
Found 5 products.