CAS 20461-89-6

1,3-Dithiane-2-carboxylic acid

Description:

1,3-Dithiane-2-carboxylic acid is a heterocyclic organic compound characterized by a six-membered ring containing two sulfur atoms and a carboxylic acid functional group. Its molecular structure features a dithiolane ring, which contributes to its unique chemical properties. The presence of the carboxylic acid group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar solvents, which enhances its utility in organic synthesis and as a building block in the preparation of more complex molecules. Additionally, 1,3-Dithiane-2-carboxylic acid can exhibit interesting reactivity due to the electron-withdrawing nature of the carboxylic acid group, influencing its behavior in nucleophilic substitution reactions. Its applications may extend to pharmaceuticals, agrochemicals, and materials science, where its unique structure can be leveraged for specific functional properties.

Formula: C₅H₈O₂S₂

InChI: InChI=1S/C5H8O2S2/c6-4(7)5-8-2-1-3-9-5/h5H,1-3H2,(H,6,7)

InChI key: InChIKey=BZBYEAWKJNCPLB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1SCCCS1

Synonyms:

• NSC 193341
• m-Dithiane-2-carboxylic acid
• 1,3-Dithiane-2-carboxylic acid

1,3-DITHIANE-2-CARBOXYLICACID

CAS: 20461-89-6

Formula: C₅H₈O₂S₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 164.2458

Ref: IN-DA0029LZ

1,3-Dithiane-2-carboxylic acid

CAS: 20461-89-6

1,3-Dithiane-2-carboxylic acid

Purity: 97%

Molecular weight: 164.25g/mol

Ref: 54-OR77183

1,3-dithiane-2-carboxylic acid

CAS: 20461-89-6

Formula: C₅H₈O₂S₂

Purity: 97%

Color and Shape: Liquid, No data available.

Molecular weight: 164.24

Ref: 10-F330364

1,3-Dithiane-2-carboxylic acid

CAS: 20461-89-6

1,3-Dithiane-2-carboxylic acid is an alkylating agent that reacts with electron-deficient substrates. It is a convenient way to access enantiopure carboxylates and unsaturated ketones in the presence of amines. This compound can also be used for the preparation of phthalimides and thioacetals. 1,3-Dithiane-2-carboxylic acid is prepared by ring opening of 1,3 dithianes. This reaction can be catalyzed by acids such as hydrochloric acid or pyridine.

Formula: C₅H₈O₂S₂

Purity: Min. 95%

Molecular weight: 164.25 g/mol

Ref: 3D-FD133944