CymitQuimica logo

CAS 20469-65-2

:

1-bromo-3,5-dimethoxybenzene

Description:
1-Bromo-3,5-dimethoxybenzene, with the CAS number 20469-65-2, is an organic compound that belongs to the class of brominated aromatic compounds. It features a benzene ring substituted with two methoxy groups (-OCH₃) at the 3 and 5 positions and a bromine atom at the 1 position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is characterized by its relatively low solubility in water but is soluble in organic solvents such as ethanol and ether. The presence of the bromine atom introduces electrophilic reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The methoxy groups enhance the electron density of the aromatic ring, influencing its reactivity and stability. 1-Bromo-3,5-dimethoxybenzene is utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Proper handling and storage are essential due to its potential hazards associated with brominated compounds.
Formula:C8H9BrO2
InChI:InChI=1/C8H9BrO2/c1-10-7-3-6(9)4-8(5-7)11-2/h3-5H,1-2H3
InChI key:KRWRFIMBWRVMKE-UHFFFAOYSA-N
SMILES:COc1cc(cc(c1)OC)Br
Synonyms:
  • 3,5-Dimethoxybromobenzene
Found 9 products.