CymitQuimica logo

CAS 205059-24-1

:

tert-butyl 4-piperidin-4-ylpiperazine-1-carboxylate

Description:
Tert-butyl 4-piperidin-4-ylpiperazine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a tert-butyl group, a piperidine ring, and a piperazine moiety. This compound typically exhibits properties associated with both piperidine and piperazine derivatives, such as potential solubility in polar solvents and moderate lipophilicity due to the presence of the tert-butyl group. It may display biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders. The presence of the carboxylate functional group suggests potential for forming salts or participating in various chemical reactions. Additionally, the compound's molecular structure may influence its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, tert-butyl 4-piperidin-4-ylpiperazine-1-carboxylate represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C14H27N3O2
InChI:InChI=1/C14H27N3O2/c1-14(2,3)19-13(18)17-10-8-16(9-11-17)12-4-6-15-7-5-12/h12,15H,4-11H2,1-3H3
InChI key:IMFPSYLOYADSFR-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCN(CC1)C1CCNCC1
Synonyms:
  • tert-Butyl 4-(piperidin-4-yl)piperazine-1-carboxylate
Found 6 products.