CAS 205115-75-9
:Lansiumarin C
Description:
Lansiumarin C is a chemical compound classified as a flavonoid, specifically a type of polyphenolic compound. It is derived from the fruit of Lansium parasiticum, commonly known as langsat or lanzones, which is native to Southeast Asia. This compound is known for its potential antioxidant properties, which may contribute to various health benefits, including anti-inflammatory and antimicrobial effects. Lansiumarin C exhibits a complex structure characterized by multiple hydroxyl groups, which enhance its reactivity and biological activity. The compound's solubility and stability can vary depending on environmental conditions, such as pH and temperature. Research into Lansiumarin C is ongoing, with studies focusing on its pharmacological potential and mechanisms of action in biological systems. As with many natural products, the extraction and purification processes are crucial for obtaining Lansiumarin C in sufficient quantities for research and potential therapeutic applications. Overall, Lansiumarin C represents an interesting subject of study within the field of natural product chemistry and its implications for health and medicine.
Formula:C21H22O5
InChI:InChI=1S/C21H22O5/c1-13(2)17(22)6-4-14(3)8-10-25-21-19-16(9-11-24-19)12-15-5-7-18(23)26-20(15)21/h5,7-9,11-12,17,22H,1,4,6,10H2,2-3H3/b14-8+/t17-/m0/s1
InChI key:InChIKey=DBHLROWQWPSCQG-AAKUMTKESA-N
SMILES:O(C/C=C(/CC[C@@H](C(C)=C)O)\C)C=1C2=C(C=C3C1OC=C3)C=CC(=O)O2
Synonyms:- 9-[[(2E,6S)-6-Hydroxy-3,7-dimethyl-2,7-octadien-1-yl]oxy]-7H-furo[3,2-g][1]benzopyran-7-one
- 7H-Furo[3,2-g][1]benzopyran-7-one, 9-[(6-hydroxy-3,7-dimethyl-2,7-octadienyl)oxy]-, (E)-(+)-
- Lansiumarin C
- 7H-Furo[3,2-g][1]benzopyran-7-one, 9-[[(2E,6S)-6-hydroxy-3,7-dimethyl-2,7-octadien-1-yl]oxy]-
- 7H-Furo[3,2-g][1]benzopyran-7-one, 9-[[(2E)-6-hydroxy-3,7-dimethyl-2,7-octadienyl]oxy]-, (+)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Lansiumarin C
CAS:Lansiumarin C can decrease nitric oxide (NO) and tumor necrosis factor-α (TNF-α) production in lipopolysaccharide (LPS)-induced macrophages.Formula:C21H22O5Purity:98%Color and Shape:SolidMolecular weight:354.4Lansiumarin C
CAS:Lansiumarin C is a natural compound, which is a secondary metabolite sourced from the fruit of the plant *Lansium domesticum*, commonly known as langsat or lanzones. This compound belongs to the class of bioactive tetranortriterpenoids, which exhibit diverse biological activities. The mode of action of Lansiumarin C involves the inhibition of specific enzymatic pathways and interaction with cellular receptors, making it notable for its potential anti-cancer, anti-inflammatory, and antimicrobial properties.Formula:C21H22O5Purity:Min. 95%Molecular weight:354.4 g/mol


