CymitQuimica logo

CAS 20514-52-7

:

3-cyclohexyl-2-methylpropanal

Description:
3-Cyclohexyl-2-methylpropanal is an organic compound characterized by its aldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The molecular structure features a cyclohexyl group and a methyl group attached to a propanal backbone, contributing to its unique physical and chemical properties. This compound typically exhibits a pleasant, sweet odor, which is common among aldehydes, and it is likely to be a colorless to pale yellow liquid at room temperature. Its boiling point and solubility characteristics can vary, but aldehydes generally have moderate volatility and are soluble in organic solvents. The presence of the cyclohexyl group may influence its steric hindrance and reactivity, making it an interesting candidate for various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, due to its structural features, 3-cyclohexyl-2-methylpropanal may find applications in the fragrance industry or as an intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage guidelines.
Formula:C10H18O
InChI:InChI=1/C10H18O/c1-9(8-11)7-10-5-3-2-4-6-10/h8-10H,2-7H2,1H3
InChI key:NYFQSZVPADHYTD-UHFFFAOYSA-N
SMILES:CC(CC1CCCCC1)C=O
Found 3 products.